CAS 852227-84-0

N-methyl-1-(3-phenylisoxazol-5-yl)methanamine hydrochloride

Description:

N-methyl-1-(3-phenylisoxazol-5-yl)methanamine hydrochloride is a chemical compound characterized by its unique structure, which includes a methanamine core substituted with a methyl group and a phenylisoxazole moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is indicative of its polar functional groups. The presence of the isoxazole ring contributes to its potential biological activity, as such heterocycles are often found in pharmacologically active compounds. The hydrochloride salt form enhances its stability and solubility, making it suitable for various applications, including research in medicinal chemistry. Its molecular interactions may involve hydrogen bonding and π-π stacking due to the aromatic nature of the phenyl group. As with many compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles would need to be evaluated in a laboratory setting. Overall, N-methyl-1-(3-phenylisoxazol-5-yl)methanamine hydrochloride represents a compound of interest in the field of drug discovery and development.

Formula: C₁₁H₁₃ClN₂O

InChI: InChI=1/C11H12N2O.ClH/c1-12-8-10-7-11(13-14-10)9-5-3-2-4-6-9;/h2-7,12H,8H2,1H3;1H

SMILES: CNCc1cc(c2ccccc2)no1.Cl