CAS 852227-92-0

3-(1H-Pyrazol-1-yl)benzaldehyde

Description:

3-(1H-Pyrazol-1-yl)benzaldehyde is an organic compound characterized by the presence of a pyrazole ring and a benzaldehyde functional group. It features a pyrazole moiety, which is a five-membered ring containing two nitrogen atoms, attached to the 3-position of a benzaldehyde structure. This compound typically exhibits properties such as being a pale yellow to light brown solid, with a distinctive aromatic odor due to the benzaldehyde group. It is soluble in organic solvents like ethanol and dichloromethane but may have limited solubility in water. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other chemical entities. Its reactivity is influenced by the aldehyde functional group, which can participate in various chemical reactions, such as condensation and nucleophilic addition. Overall, 3-(1H-Pyrazol-1-yl)benzaldehyde serves as a valuable building block in organic synthesis and research.

Formula: C₁₀H₈N₂O

InChI: InChI=1/C10H8N2O/c13-8-9-3-1-4-10(7-9)12-6-2-5-11-12/h1-8H

InChI key: InChIKey=NKFXXJOWQSOGOF-UHFFFAOYSA-N

SMILES: C(=O)C=1C=C(C=CC1)N2C=CC=N2

Synonyms:

• 3-(Pyrazol-1-yl)benzaldehyde
• Benzaldehyde, 3-(1H-pyrazol-1-yl)-
• 3-(1H-Pyrazol-1-yl)benzaldehyde

3-(1H-Pyrazol-1-yl)benzaldehyde

CAS: 852227-92-0

Formula: C₁₀H₈N₂O

Purity: 95%

Color and Shape: Liquid

Molecular weight: 172.1833

Ref: IN-DA008FUU

3-(1H-Pyrazol-1-yl)benzaldehyde

CAS: 852227-92-0

3-(1H-Pyrazol-1-yl)benzaldehyde

Formula: C₁₀H₈N₂O

Purity: By hplc: 99.0% (Typical Value in Batch COA)

Color and Shape: pale yellow low-melting solid

Molecular weight: 172.18g/mol

Ref: 54-OR5681

3-Pyrazol-1-yl-benzaldehyde

CAS: 852227-92-0

Formula: C₁₀H₈N₂O

Purity: 95%

Molecular weight: 172.187

Ref: 10-F031278

3-(1H-Pyrazol-1-yl)benzaldehyde

CAS: 852227-92-0

3-(1H-Pyrazol-1-yl)benzaldehyde is an oxime that is used as a ligand in coordination chemistry. It has been shown to catalyze the coupling of piperidine and aryl halides, yielding carboxylic acid derivatives. 3-(1H-Pyrazol-1-yl)benzaldehyde also efficiently catalyzes the synthesis of pharmaceuticals containing pyrrolidines, such as amino acids or nucleophiles. 3-(1H-Pyrazol-1-yl)benzaldehyde is a good ligand for metal ions due to its ability to form strong bonds with them. In addition, it can be used as an additive in the synthesis of amines and imines due to its ability to chelate metals.

Formula: C₁₀H₈N₂O

Purity: Min. 95%

Molecular weight: 172.19 g/mol

Ref: 3D-CJB22792