CAS 852228-11-6

5-Borono-2-furancarboxylic acid

Description:

5-Borono-2-furancarboxylic acid is an organic compound characterized by the presence of a boronic acid functional group and a furan ring. It features a boron atom bonded to a hydroxyl group and an aryl group, which in this case is a furan derivative. The compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its carboxylic acid and boronic acid functionalities. It is often used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, which are valuable for forming carbon-carbon bonds. The presence of both the boronic acid and the furan ring allows for versatile reactivity, making it useful in the development of pharmaceuticals and agrochemicals. Additionally, 5-Borono-2-furancarboxylic acid can serve as a building block in the synthesis of more complex molecules, contributing to its significance in medicinal chemistry and materials science. Its stability and reactivity under various conditions make it a valuable compound in research and industrial applications.

Formula: C₅H₅BO₅

InChI: InChI=1S/C5H5BO5/c7-5(8)3-1-2-4(11-3)6(9)10/h1-2,9-10H,(H,7,8)

InChI key: InChIKey=QZCYESBSCBYIFJ-UHFFFAOYSA-N

SMILES: B(O)(O)C=1OC(C(O)=O)=CC1

Synonyms:

• 5-Borono-2-furancarboxylic acid
• 2-Furancarboxylic acid, 5-borono-
• 5-(Dihydroxyboryl)-2-furoic acid
• 5-Boronofuran-2-carboxylic acid

5-Carboxyfuran-2-boronic acid

CAS: 852228-11-6

Formula: C₅H₅BO₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.9012

Ref: IN-DA008FUS

5-Carboxyfuran-2-boronic acid

CAS: 852228-11-6

5-Carboxyfuran-2-boronic acid

Purity: 96%

Color and Shape: Solid

Molecular weight: 155.90g/mol

Ref: 54-OR360876

5-Boronofuran-2-carboxylic acid

CAS: 852228-11-6

Formula: C₅H₅BO₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.9

Ref: 10-F048715