CymitQuimica logo

CAS 852228-14-9

:

(2,5-dibromopyridin-3-yl)boronic acid

Description:
(2,5-Dibromopyridin-3-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is substituted with two bromine atoms. This compound typically exhibits properties associated with both boronic acids and halogenated aromatic compounds. It is likely to be a solid at room temperature, with moderate solubility in polar solvents such as water and alcohols, due to the presence of the boronic acid group. The bromine substituents can influence its reactivity, making it useful in cross-coupling reactions, particularly in the synthesis of complex organic molecules. The boronic acid functionality allows for the formation of reversible covalent bonds with diols, which is significant in various applications, including drug development and materials science. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose health risks, and proper handling procedures should be followed.
Formula:C5H4BBr2NO2
InChI:InChI=1/C5H4BBr2NO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H
InChI key:CBWWZYPUCZRZGD-UHFFFAOYSA-N
SMILES:c1c(cnc(c1B(O)O)Br)Br
Synonyms:
  • 2,5-Dibromo-3-Pyridinylboronic Acid
  • boronic acid, B-(2,5-dibromo-3-pyridinyl)-
  • (2,5-Dibromopyridin-3-yl)boronic acid
Found 3 products.