CAS 85228-11-1
:Dolicholide
Description:
Dolicholide is a chemical compound classified as a polyisoprenoid, specifically a type of dolichol, which is a long-chain alcohol composed of multiple isoprene units. It is characterized by its hydrophobic nature due to the long hydrocarbon chain, which typically consists of 15 to 20 isoprene units. Dolicholide plays a significant role in biological systems, particularly in the synthesis of glycoproteins, as it serves as a carrier for oligosaccharides during the glycosylation process. Its structure allows it to embed within cellular membranes, influencing membrane fluidity and protein interactions. Dolicholide is also of interest in research related to cell signaling and the development of certain diseases. The compound is generally studied in the context of its biochemical functions and potential therapeutic applications, particularly in relation to its role in cellular metabolism and the biosynthesis of essential biomolecules. As with many polyisoprenoids, dolicholide's properties can vary based on its specific chain length and degree of saturation.
Formula:C28H46O6
InChI:InChI=1S/C28H46O6/c1-14(2)15(3)24(31)25(32)16(4)18-7-8-19-17-13-34-26(33)21-11-22(29)23(30)12-28(21,6)20(17)9-10-27(18,19)5/h14,16-25,29-32H,3,7-13H2,1-2,4-6H3/t16-,17-,18+,19-,20-,21+,22-,23+,24+,25+,27+,28+/m0/s1
InChI key:InChIKey=PPFRJNLKWADOTL-WOGJWQOOSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@@](C(=O)OC3)(C[C@H](O)[C@H](O)C4)[H])(CC1)[H])[H])(CC[C@@]2([C@@H]([C@H]([C@@H](C(C(C)C)=C)O)O)C)[H])[H]
Synonyms:- Dolicholide
- 6H-Benz[c]indeno[5,4-e]oxepin-6-one, 1-[(1S,2R,3R)-2,3-dihydroxy-1,5-dimethyl-4-methylenehexyl]hexadecahydro-8,9-dihydroxy-10a,12a-dimethyl-, (1R,3aS,3bS,6aS,8S,9R,10aR,10bS,12aS)-
- 6H-Benz[c]indeno[5,4-e]oxepin-6-one, 1-(2,3-dihydroxy-1,5-dimethyl-4-methylenehexyl)hexadecahydro-8,9-dihydroxy-10a,12a-dimethyl-, [1R-[1α(1S*,2R*,3R*),3aβ,3bα,6aβ,8β,9β,10aα,10bβ,12aα]]-
- (1R,3aS,3bS,6aS,8S,9R,10aR,10bS,12aS)-1-[(1S,2R,3R)-2,3-Dihydroxy-1,5-dimethyl-4-methylenehexyl]hexadecahydro-8,9-dihydroxy-10a,12a-dimethyl-6H-benz[c]indeno[5,4-e]oxepin-6-one
- B-Homo-7-oxaergost-24(28)-en-6-one, 2,3,22,23-tetrahydroxy-, (2α,3α,5α,22R,23R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.