CAS 852291-42-0
:Thiazolo[5,4-c]pyridine, 2-bromo-4,5,6,7-tetrahydro-5-methyl-, 4-methylbenzenesulfonate (1:1)
Description:
Thiazolo[5,4-c]pyridine, 2-bromo-4,5,6,7-tetrahydro-5-methyl-, 4-methylbenzenesulfonate (1:1) is a complex organic compound characterized by its unique bicyclic structure that incorporates both thiazole and pyridine moieties. The presence of a bromine atom at the 2-position and a methyl group at the 5-position of the tetrahydro structure contributes to its reactivity and potential biological activity. The sulfonate group, derived from 4-methylbenzenesulfonic acid, enhances the compound's solubility in polar solvents and may influence its interaction with biological targets. This compound is likely to exhibit properties typical of heterocyclic compounds, such as potential pharmacological activities, including antimicrobial or anticancer effects, due to the presence of the thiazole and pyridine rings. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be of interest in medicinal chemistry and drug development. As with many such compounds, safety and handling precautions are essential due to the presence of halogenated and sulfonated groups.
Formula:C7H9BrN2S·C7H8O3S
InChI:InChI=1S/C7H9BrN2S.C7H8O3S/c1-10-3-2-5-6(4-10)11-7(8)9-5;1-6-2-4-7(5-3-6)11(8,9)10/h2-4H2,1H3;2-5H,1H3,(H,8,9,10)
InChI key:InChIKey=AIEULOVGRIAJCY-UHFFFAOYSA-N
SMILES:BrC1=NC2=C(S1)CN(C)CC2.S(=O)(=O)(O)C1=CC=C(C)C=C1
Synonyms:- Thiazolo[5,4-c]pyridine, 2-bromo-4,5,6,7-tetrahydro-5-methyl-, mono(4-methylbenzenesulfonate)
- Thiazolo[5,4-c]pyridine, 2-bromo-4,5,6,7-tetrahydro-5-methyl-, 4-methylbenzenesulfonate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
