CymitQuimica logo

CAS 852296-85-6

:

5-(4-fluorophenyl)thiophene-2-carbohydrazide

Description:
5-(4-Fluorophenyl)thiophene-2-carbohydrazide is an organic compound characterized by its unique structure, which includes a thiophene ring, a hydrazide functional group, and a fluorophenyl substituent. The presence of the thiophene ring contributes to its aromatic properties and potential electronic characteristics, while the hydrazide group can participate in various chemical reactions, including hydrazone formation and potential biological activity. The fluorine atom in the para position of the phenyl ring can influence the compound's reactivity and solubility, as well as its interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds with specific biological activities. Additionally, the compound's stability and reactivity can be influenced by the presence of the fluorine atom, which can enhance lipophilicity and alter the compound's pharmacokinetic profile. Overall, 5-(4-fluorophenyl)thiophene-2-carbohydrazide represents a versatile scaffold for further exploration in chemical and pharmaceutical research.
Formula:C11H9FN2OS
InChI:InChI=1/C11H9FN2OS/c12-8-3-1-7(2-4-8)9-5-6-10(16-9)11(15)14-13/h1-6H,13H2,(H,14,15)
SMILES:c1cc(ccc1c1ccc(C(=O)NN)s1)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.