CymitQuimica logo

CAS 852313-97-4

:

1-(2-Bromophenyl)-4-chloro-1H-pyrazolo[3,4-d]pyrimidine

Description:
1-(2-Bromophenyl)-4-chloro-1H-pyrazolo[3,4-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a bromophenyl group and a chlorine substituent, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent and conditions. The presence of halogen atoms (bromine and chlorine) can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, this compound may possess biological activity, which has led to interest in its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for interactions with biological targets, which can be explored in drug discovery processes. As with many heterocycles, the stability and reactivity of this compound can be affected by environmental factors such as pH and temperature.
Formula:C11H6BrClN4
InChI:InChI=1S/C11H6BrClN4/c12-8-3-1-2-4-9(8)17-11-7(5-16-17)10(13)14-6-15-11/h1-6H
InChI key:InChIKey=YUXGRVCLWMPBBG-UHFFFAOYSA-N
SMILES:BrC1=C(N2C=3C(C=N2)=C(Cl)N=CN3)C=CC=C1
Synonyms:
  • 1-(2-Bromophenyl)-4-chloro-1H-pyrazolo[3,4-d]pyrimidine
  • 1-(2-Bromophenyl)-4-chloropyrazolo[3,4-d]pyrimidine
  • 1H-Pyrazolo[3,4-d]pyrimidine, 1-(2-bromophenyl)-4-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.