CAS 85233-21-2
:2,2',2'',2'''-{ethane-1,2-diylbis[oxy(5-fluorobenzene-2,1-diyl)nitrilo]}tetraacetic acid
Description:
The chemical substance known as "2,2',2'',2'''-{ethane-1,2-diylbis[oxy(5-fluorobenzene-2,1-diyl)nitrilo]}tetraacetic acid," with the CAS number 85233-21-2, is a complex organic compound characterized by its tetracarboxylic acid structure. This compound features multiple functional groups, including carboxylic acid and nitrile groups, which contribute to its potential applications in coordination chemistry and as a chelating agent. The presence of fluorine in the aromatic ring may enhance its lipophilicity and influence its reactivity. The ethane-1,2-diyl linker connects the aromatic moieties, providing a degree of flexibility and spatial arrangement that can affect its binding properties. Such compounds are often studied for their ability to form stable complexes with metal ions, making them of interest in fields like medicinal chemistry, environmental science, and materials science. Additionally, the specific arrangement of functional groups can impact the compound's solubility, stability, and overall chemical behavior in various environments.
Formula:C22H22F2N2O10
InChI:InChI=1/C22H22F2N2O10/c23-13-1-3-17(15(7-13)25(9-19(27)28)10-20(29)30)35-5-6-36-18-4-2-14(24)8-16(18)26(11-21(31)32)12-22(33)34/h1-4,7-8H,5-6,9-12H2,(H,27,28)(H,29,30)(H,31,32)(H,33,34)
SMILES:c1cc(c(cc1F)N(CC(=O)O)CC(=O)O)OCCOc1ccc(cc1N(CC(=O)O)CC(=O)O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.