CAS 852336-30-2
:1-butyl-4-(2-methylprop-2-enyl)benzene
Description:
1-Butyl-4-(2-methylprop-2-enyl)benzene, also known by its CAS number 852336-30-2, is an organic compound characterized by its aromatic structure, which includes a butyl group and an allylic substituent. This compound features a benzene ring substituted at the para position with a butyl group and a 2-methylprop-2-enyl group, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinct aromatic odor. The presence of both aliphatic and aromatic components suggests that it may exhibit hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. Its structure indicates potential reactivity due to the presence of the double bond in the allylic group, which can participate in various chemical reactions such as polymerization or electrophilic addition. Additionally, the compound may have applications in organic synthesis, fragrance formulations, or as an intermediate in the production of other chemical substances. Safety data should be consulted for handling and exposure guidelines.
Formula:C14H20
InChI:InChI=1/C14H20/c1-4-5-6-13-7-9-14(10-8-13)11-12(2)3/h7-10H,2,4-6,11H2,1,3H3
SMILES:CCCCc1ccc(cc1)CC(=C)C
Synonyms:- 1-Butyl-4-(2-methylprop-2-en-1-yl)benzene
- Benzene, 1-Butyl-4-(2-Methyl-2-Propen-1-Yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.