CAS 852362-24-4
:B-4-Pyrimidinylboronic acid
Description:
B-4-Pyrimidinylboronic acid, identified by its CAS number 852362-24-4, is an organoboron compound characterized by the presence of a pyrimidine ring and a boronic acid functional group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing a moderate molecular weight. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. It can act as a ligand in coordination chemistry and is often employed in the development of pharmaceuticals, particularly in the context of drug design targeting specific biological pathways. Additionally, B-4-Pyrimidinylboronic acid may exhibit unique reactivity patterns due to the electron-withdrawing nature of the pyrimidine ring, influencing its chemical behavior in reactions. Overall, this compound is significant in both academic research and industrial applications due to its versatile chemical properties.
Formula:C4H5BN2O2
InChI:InChI=1S/C4H5BN2O2/c8-5(9)4-1-2-6-3-7-4/h1-3,8-9H
InChI key:InChIKey=YQEFFTJDRKXKAP-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=CN=CN1
Synonyms:- 852362-24-4
- B-4-Pyrimidinylboronic acid
- Boronic acid, 4-pyrimidinyl-
- Boronic acid, B-4-pyrimidinyl-
- Pyrimidin-4-ylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyrimidin-4-ylboronic acid
CAS:Formula:C4H5BN2O2Purity:97%Color and Shape:SolidMolecular weight:123.9057Pyrimidine-4-boronic acid
CAS:Pyrimidine-4-boronic acid is a pyrimidine derivative that is used as a building block or intermediate in organic chemistry. It has the CAS number 852362-24-4 and can be found in research chemicals and speciality chemicals. Pyrimidine-4-boronic acid is a versatile chemical with many uses, including as a reaction component or reagent. This compound has many properties that make it useful for synthesis, such as its low toxicity and high quality.Formula:C4H5BN2O2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:123.91 g/molPyrimidine-4-boronic acid
CAS:Formula:C4H5BN2O2Purity:95%Color and Shape:SolidMolecular weight:123.91Pyrimidin-4-ylboronic Acid (~80%)
CAS:Controlled ProductApplications Pyrimidin-4-ylboronic Acid is an intermediate used to prepare aldosterone synthase inhibiting pyrimidinylnaphthalenes via Suzuki cross-coupling reactions. It is also used in the synthesis of [7-(2,6-dichlorophenyl)-5-methylbenzo [1,2,4]triazin-3-yl]-[4-(2-pyrrolidin-1-ylethoxy)phenyl]amine as a potent, orally active Src kinase inhibitor with antitumor activity.
References Voets, M., et al.; J. Med. Chem., 48, 6632 (2005); Noronha, G., et al.: Bioorg. Med. Chem. Lett., 17, 602 (2007)Formula:C4H5BN2O2Purity:~80%Color and Shape:NeatMolecular weight:123.91



