CAS 852362-25-5
:Quinoxalin-6-ylboronic acid hydrochloride (1:1)
Description:
Quinoxalin-6-ylboronic acid hydrochloride is a chemical compound characterized by its boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in organic synthesis and medicinal chemistry. The compound features a quinoxaline ring, a bicyclic structure that contributes to its biological activity and potential as a pharmacophore. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological studies. The presence of the boronic acid moiety allows for participation in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. This compound may exhibit properties such as moderate stability under standard conditions, and its reactivity can be influenced by the pH of the environment. Overall, quinoxalin-6-ylboronic acid hydrochloride is a versatile building block in chemical synthesis and has potential applications in drug development and material science.
Formula:C8H8BClN2O2
InChI:InChI=1/C8H7BN2O2.ClH/c12-9(13)6-1-2-7-8(5-6)11-4-3-10-7;/h1-5,12-13H;1H
SMILES:c1cc2c(cc1B(O)O)nccn2.Cl
Synonyms:- boronic acid, B-6-quinoxalinyl-, hydrochloride (1:1)
- Benzopyrazine-6-boronic acid Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Quinoxalin-6-ylboronic acid hydrochloride
CAS:Formula:C8H8BClN2O2Purity:98%Color and Shape:SolidMolecular weight:210.4253Quinoxalin-6-ylboronic acid hydrochloride
CAS:Quinoxalin-6-ylboronic acid hydrochloridePurity:≥95%Molecular weight:210.43g/molQuinoxalin-6-ylboronic acid hydrochloride
CAS:Formula:C8H8BClN2O2Purity:98%Color and Shape:Liquid, No data available.Molecular weight:210.42Benzopyrazine-6-boronic acidHCl
CAS:Please enquire for more information about Benzopyrazine-6-boronic acidHCl including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H8BClN2O2Purity:Min. 95%Molecular weight:210.43 g/mol



