CAS 85237-69-0

2-(4-Methylcyclohexyl)piperidine

Description:

2-(4-Methylcyclohexyl)piperidine, with the CAS number 85237-69-0, is an organic compound characterized by its piperidine ring structure substituted with a 4-methylcyclohexyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in organic solvents and limited solubility in water, which is common for many piperidine derivatives. The presence of the cyclohexyl group contributes to its hydrophobic characteristics, influencing its interactions in biological systems and chemical reactions. This compound may exhibit basic properties due to the nitrogen atom in the piperidine ring, allowing it to participate in protonation and nucleophilic reactions. Additionally, it may have applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₁₂H₂₃N

InChI: InChI=1S/C12H23N/c1-10-5-7-11(8-6-10)12-4-2-3-9-13-12/h10-13H,2-9H2,1H3

InChI key: InChIKey=JBVLZTOPFKHUJA-UHFFFAOYSA-N

SMILES: CC1CCC(CC1)C2CCCCN2

Synonyms:

• 2-(4-Methylcyclohexyl)piperidine
• Piperidine, 2-(4-methylcyclohexyl)-