CAS 852388-73-9

2-Chloro-1-[2,3-dihydro-2-methyl-1-(methylsulfonyl)-1H-indol-5-yl]ethanone

Description:

2-Chloro-1-[2,3-dihydro-2-methyl-1-(methylsulfonyl)-1H-indol-5-yl]ethanone, with the CAS number 852388-73-9, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, an indole moiety, and a methylsulfonyl functional group. This compound typically exhibits properties associated with indole derivatives, such as potential biological activity, including anti-inflammatory or analgesic effects, although specific biological data may vary. The presence of the chloro substituent can influence its reactivity and solubility in various solvents. The methylsulfonyl group may enhance its pharmacokinetic properties, potentially affecting its metabolism and bioavailability. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks. Overall, this compound represents a class of molecules that may have applications in medicinal chemistry and drug development.

Formula: C₁₂H₁₄ClNO₃S

InChI: InChI=1S/C12H14ClNO3S/c1-8-5-10-6-9(12(15)7-13)3-4-11(10)14(8)18(2,16)17/h3-4,6,8H,5,7H2,1-2H3

InChI key: InChIKey=XMQKAOPPPSIZOK-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)N1C=2C(=CC(C(CCl)=O)=CC2)CC1C

Synonyms:

• 2-Chloro-1-[2,3-dihydro-2-methyl-1-(methylsulfonyl)-1H-indol-5-yl]ethanone
• Ethanone, 2-chloro-1-[2,3-dihydro-2-methyl-1-(methylsulfonyl)-1H-indol-5-yl]-

2-Chloro-1-(1-methanesulfonyl-2-methyl-2,3-dihydro-1H-indol-5-yl)ethan-1-one

CAS: 852388-73-9

Versatile small molecule scaffold

Formula: C₁₂H₁₄ClNO₃S

Purity: Min. 95%

Molecular weight: 287.76 g/mol

Ref: 3D-CJB38873