CymitQuimica logo

CAS 852388-82-0

:

Ethyl 5-acetyl-1,2-dihydro-6-hydroxy-2-imino-1-methyl-3-pyridinecarboxylate

Description:
Ethyl 5-acetyl-1,2-dihydro-6-hydroxy-2-imino-1-methyl-3-pyridinecarboxylate, with the CAS number 852388-82-0, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with various functional groups, including an acetyl group, a hydroxy group, and an imino group, which contribute to its chemical reactivity and potential biological activity. The presence of the ethyl ester group suggests that it may exhibit properties typical of esters, such as solubility in organic solvents and potential for hydrolysis. The compound's structure indicates it may participate in hydrogen bonding due to the hydroxyl and imino functionalities, which could influence its interactions in biological systems. Additionally, the presence of multiple functional groups may allow for diverse reactivity, making it of interest in medicinal chemistry and synthetic applications. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C11H14N2O4
InChI:InChI=1S/C11H14N2O4/c1-4-17-11(16)8-5-7(6(2)14)10(15)13(3)9(8)12/h5,12,15H,4H2,1-3H3
InChI key:InChIKey=RNOMTUDGOYEEJY-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(C(C)=O)=C(O)N(C)C1=N
Synonyms:
  • Ethyl 5-acetyl-1,2-dihydro-6-hydroxy-2-imino-1-methyl-3-pyridinecarboxylate
  • 3-Pyridinecarboxylic acid, 5-acetyl-1,2-dihydro-6-hydroxy-2-imino-1-methyl-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.