CymitQuimica logo

CAS 852388-92-2

:

2-Chloro-N-[3-cyano-4,5-dimethyl-1-(2-thienylmethyl)-1H-pyrrol-2-yl]acetamide

Description:
2-Chloro-N-[3-cyano-4,5-dimethyl-1-(2-thienylmethyl)-1H-pyrrol-2-yl]acetamide, with the CAS number 852388-92-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a chloro group, a cyano group, and a pyrrole ring. This compound features a thienylmethyl substituent, contributing to its unique chemical properties. It is typically classified as an amide due to the presence of the acetamide functional group. The presence of multiple functional groups suggests potential reactivity, making it of interest in medicinal chemistry and drug development. The compound's molecular structure may influence its solubility, stability, and biological activity, which are critical factors in its application. Additionally, the presence of the cyano group may impart specific electronic properties, while the thienyl moiety can enhance interactions with biological targets. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules used in various chemical and pharmaceutical applications.
Formula:C14H14ClN3OS
InChI:InChI=1S/C14H14ClN3OS/c1-9-10(2)18(8-11-4-3-5-20-11)14(12(9)7-16)17-13(19)6-15/h3-5H,6,8H2,1-2H3,(H,17,19)
InChI key:InChIKey=LIEMSBPQNKXNBW-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C=1N(CC2=CC=CS2)C(C)=C(C)C1C#N
Synonyms:
  • Acetamide, 2-chloro-N-[3-cyano-4,5-dimethyl-1-(2-thienylmethyl)-1H-pyrrol-2-yl]-
  • 2-Chloro-N-[3-cyano-4,5-dimethyl-1-(2-thienylmethyl)-1H-pyrrol-2-yl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.