CAS 852399-55-4

8-Chloro-2,3-dihydro-1,4-benzodioxin-6-methanol

Description:

8-Chloro-2,3-dihydro-1,4-benzodioxin-6-methanol is a chemical compound characterized by its unique structure, which includes a benzodioxin core with a chlorine substituent and a methanol group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the chlorine atom can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The methanol group may also impart solubility in polar solvents, enhancing its utility in organic synthesis and pharmaceutical applications. Additionally, compounds of this nature may exhibit biological activity, which could be of interest in medicinal chemistry. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise determination. Overall, 8-Chloro-2,3-dihydro-1,4-benzodioxin-6-methanol represents a versatile structure in organic chemistry with potential applications in various fields.

Formula: C₉H₉ClO₃

InChI: InChI=1S/C9H9ClO3/c10-7-3-6(5-11)4-8-9(7)13-2-1-12-8/h3-4,11H,1-2,5H2

InChI key: InChIKey=NZTJZGZSCQLALN-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC(CO)=C1)OCCO2

Synonyms:

• 8-Chloro-2,3-dihydro-1,4-benzodioxin-6-methanol
• 1,4-Benzodioxin-6-methanol, 8-chloro-2,3-dihydro-

(8-Chloro-2,3-dihydro-1,4-benzodioxin-6-yl)methanol

CAS: 852399-55-4

Versatile small molecule scaffold

Formula: C₉H₉ClO₃

Purity: Min. 95%

Molecular weight: 200.62 g/mol

Ref: 3D-CJB39955