CAS 852399-57-6
:4-Methyl-2-oxo-3(2H)-thiazolepropanoic acid
Description:
4-Methyl-2-oxo-3(2H)-thiazolepropanoic acid, identified by its CAS number 852399-57-6, is a chemical compound characterized by its thiazole ring structure, which contributes to its unique reactivity and properties. This compound features a methyl group and a keto group, which enhance its potential for various chemical reactions, including nucleophilic attacks and condensation reactions. The presence of the thiazole moiety imparts biological significance, as thiazoles are often found in pharmaceuticals and agrochemicals. Additionally, the carboxylic acid functional group in its structure suggests that it can participate in acid-base reactions and may exhibit solubility in polar solvents. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. Overall, 4-Methyl-2-oxo-3(2H)-thiazolepropanoic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C7H9NO3S
InChI:InChI=1S/C7H9NO3S/c1-5-4-12-7(11)8(5)3-2-6(9)10/h4H,2-3H2,1H3,(H,9,10)
InChI key:InChIKey=DXKOQSONWZQQNV-UHFFFAOYSA-N
SMILES:C(CC(O)=O)N1C(C)=CSC1=O
Synonyms:- 4-Methyl-2-oxo-3(2H)-thiazolepropanoic acid
- 3(2H)-Thiazolepropanoic acid, 4-methyl-2-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.