CymitQuimica logo

CAS 852399-71-4

:

Dihydro-1-(1-methylbutyl)-2-thioxo-4,6(1H,5H)-pyrimidinedione

Description:
Dihydro-1-(1-methylbutyl)-2-thioxo-4,6(1H,5H)-pyrimidinedione, with the CAS number 852399-71-4, is a chemical compound that belongs to the class of pyrimidinediones, which are characterized by a pyrimidine ring containing two carbonyl groups. This specific compound features a thioxo group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of the 1-methylbutyl substituent suggests that it may exhibit hydrophobic properties, influencing its solubility and interaction with biological membranes. Pyrimidinediones are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The compound's structure may allow for various interactions with biological targets, making it of interest in drug development. However, detailed studies on its specific properties, such as melting point, solubility, and biological activity, would be necessary to fully understand its potential applications and safety profile.
Formula:C9H14N2O2S
InChI:InChI=1S/C9H14N2O2S/c1-3-4-6(2)11-8(13)5-7(12)10-9(11)14/h6H,3-5H2,1-2H3,(H,10,12,14)
InChI key:InChIKey=DJMVYEYGMJZIDW-UHFFFAOYSA-N
SMILES:C(CCC)(C)N1C(=O)CC(=O)NC1=S
Synonyms:
  • Dihydro-1-(1-methylbutyl)-2-thioxo-4,6(1H,5H)-pyrimidinedione
  • 4,6(1H,5H)-Pyrimidinedione, dihydro-1-(1-methylbutyl)-2-thioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.