
CAS 852399-75-8
:Methyl 2-[(1-pyrrolidinylthioxomethyl)thio]acetate
Description:
Methyl 2-[(1-pyrrolidinylthioxomethyl)thio]acetate is a chemical compound characterized by its unique structure, which includes a methyl ester functional group and a thioether linkage. This compound features a pyrrolidine ring, contributing to its potential biological activity and interaction with various biological systems. The presence of a thioxomethyl group suggests that it may exhibit reactivity typical of thioketones, potentially participating in nucleophilic addition reactions. Methyl esters are generally known for their volatility and solubility in organic solvents, which can influence the compound's behavior in different environments. Additionally, the thioether moiety may impart specific properties such as increased lipophilicity, affecting its pharmacokinetics if considered for medicinal applications. Overall, the compound's characteristics, including its molecular structure and functional groups, suggest potential utility in organic synthesis and possibly in pharmaceutical development, although specific biological activities would require further investigation through empirical studies.
Formula:C8H13NO2S2
InChI:InChI=1S/C8H13NO2S2/c1-11-7(10)6-13-8(12)9-4-2-3-5-9/h2-6H2,1H3
InChI key:InChIKey=BUWIQLRAMLHWNG-UHFFFAOYSA-N
SMILES:C(SCC(OC)=O)(=S)N1CCCC1
Synonyms:- Acetic acid, 2-[(1-pyrrolidinylthioxomethyl)thio]-, methyl ester
- Methyl 2-[(1-pyrrolidinylthioxomethyl)thio]acetate
- Acetic acid, [(1-pyrrolidinylthioxomethyl)thio]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.