CymitQuimica logo

CAS 852400-09-0

:

2-(2-Benzothiazolyl)cyclohexanecarboxylic acid

Description:
2-(2-Benzothiazolyl)cyclohexanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a cyclohexanecarboxylic acid group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the benzothiazole ring often imparts biological activity, making it of interest in medicinal chemistry for its potential therapeutic effects. Additionally, the cyclohexanecarboxylic acid component may influence solubility and reactivity, affecting how the compound interacts in different environments. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can be critical for its behavior in biological systems or as a functional material. Overall, 2-(2-Benzothiazolyl)cyclohexanecarboxylic acid is a versatile compound with properties that warrant further investigation for its potential applications in various scientific domains.
Formula:C14H15NO2S
InChI:InChI=1S/C14H15NO2S/c16-14(17)10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)18-13/h3-4,7-10H,1-2,5-6H2,(H,16,17)
InChI key:InChIKey=UYUNBKRWYMGAKX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(C2=NC=3C(S2)=CC=CC3)CCCC1
Synonyms:
  • 2-(2-Benzothiazolyl)cyclohexanecarboxylic acid
  • Cyclohexanecarboxylic acid, 2-(2-benzothiazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.