CymitQuimica logo

CAS 852400-13-6

:

Ethyl 3-[(2-chloroacetyl)amino]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate

Description:
Ethyl 3-[(2-chloroacetyl)amino]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate is a chemical compound characterized by its complex structure, which includes a thieno[2,3-b]pyridine core, an ethyl ester group, and a chloroacetylamino substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its nitrogen and sulfur-containing ring system. The presence of the chloroacetyl group may impart reactivity, making it a candidate for further chemical modifications or biological interactions. Ethyl esters generally have moderate solubility in organic solvents and may exhibit varying degrees of stability depending on environmental conditions. The compound's specific applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and reactivity. As with many synthetic organic compounds, safety and handling precautions are essential, particularly due to the presence of the chloro group, which can be hazardous. Overall, this compound represents a unique structure with potential utility in various chemical and biological contexts.
Formula:C14H15ClN2O3S
InChI:InChI=1S/C14H15ClN2O3S/c1-4-20-14(19)12-11(17-9(18)6-15)10-7(2)5-8(3)16-13(10)21-12/h5H,4,6H2,1-3H3,(H,17,18)
InChI key:InChIKey=UQNQPTLBUPYUBL-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C=1C=2C(SC1C(OCC)=O)=NC(C)=CC2C
Synonyms:
  • Thieno[2,3-b]pyridine-2-carboxylic acid, 3-[(2-chloroacetyl)amino]-4,6-dimethyl-, ethyl ester
  • Ethyl 3-[(2-chloroacetyl)amino]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.