CAS 852400-51-2
:1,3-Dihydro-5-(4-methylphenyl)-1-phenyl-2H-imidazole-2-thione
Description:
1,3-Dihydro-5-(4-methylphenyl)-1-phenyl-2H-imidazole-2-thione is a heterocyclic compound characterized by its imidazole ring structure, which contains sulfur in the thione form. This compound features a fused bicyclic system, with substituents that include a 4-methylphenyl group and a phenyl group, contributing to its aromatic character. The presence of the thione functional group indicates that it can exhibit properties typical of thioketones, such as potential reactivity in nucleophilic addition reactions. The compound's structure suggests it may possess biological activity, making it of interest in medicinal chemistry. Additionally, its molecular configuration may influence its solubility, stability, and interaction with biological targets. As with many imidazole derivatives, it may also exhibit properties such as fluorescence or photostability, depending on the specific arrangement of its substituents. Overall, 1,3-Dihydro-5-(4-methylphenyl)-1-phenyl-2H-imidazole-2-thione is a complex organic molecule with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C16H14N2S
InChI:InChI=1S/C16H14N2S/c1-12-7-9-13(10-8-12)15-11-17-16(19)18(15)14-5-3-2-4-6-14/h2-11H,1H3,(H,17,19)
InChI key:InChIKey=GVSVUBISEJFHJQ-UHFFFAOYSA-N
SMILES:S=C1N(C(=CN1)C2=CC=C(C)C=C2)C3=CC=CC=C3
Synonyms:- 1,3-Dihydro-5-(4-methylphenyl)-1-phenyl-2H-imidazole-2-thione
- 2H-Imidazole-2-thione, 1,3-dihydro-5-(4-methylphenyl)-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.