CAS 852458-12-9

1-Butenylboronic acid

Description:

1-Butenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a butenyl chain. It typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. This compound is known for its reactivity, particularly in cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The boronic acid moiety allows for the formation of stable complexes with diols, which is useful in various applications, including the development of sensors and drug delivery systems. Additionally, 1-butenylboronic acid can participate in Suzuki-Miyaura coupling reactions, facilitating the formation of carbon-carbon bonds. Its structure includes a double bond, which contributes to its reactivity and potential applications in polymer chemistry. As with many organoboron compounds, handling requires caution due to potential reactivity and the need for proper storage conditions to maintain stability.

Formula: C₄H₉BO₂

InChI: InChI=1/C4H9BO2/c1-2-3-4-5(6)7/h3-4,6-7H,2H2,1H3

SMILES: CCC=CB(O)O

But-1-en-2-ylboronic acid

CAS: 852458-12-9

Formula: C₄H₉BO₂

Color and Shape: Solid

Molecular weight: 99.9241

Ref: IN-DA004LUX

1-Butenylboronic acid

CAS: 852458-12-9

1-Butenylboronic acid

Purity: ≥95%

Molecular weight: 99.92g/mol

Ref: 54-OR908336

1(E)-Butenylboronic Acid

Controlled Product

CAS: 852458-12-9

Applications 1-Butenylboronic Acid is a reagent used in the synthesis of polyene natural products.
References Lee, S. J., et al.: J. Am. Chem. Soc., 130, 466-468 (2008)

Formula: C₄H₉BO₂

Color and Shape: Neat

Molecular weight: 99.92

Ref: TR-B690210