
CAS 85252-27-3
:2-Hydroxy-5,6-ditetradecyl-1,3,2-benzodioxaborole
Description:
2-Hydroxy-5,6-ditetradecyl-1,3,2-benzodioxaborole is a chemical compound characterized by its unique structure, which includes a benzodioxaborole framework. This compound features two tetradecyl chains, contributing to its hydrophobic properties, while the hydroxyl group provides potential for hydrogen bonding and solubility in polar solvents. The presence of boron in its structure suggests potential applications in materials science and organic synthesis, particularly in the development of boron-containing compounds. Its molecular structure may also impart interesting electronic properties, making it a candidate for use in organic electronics or as a ligand in coordination chemistry. The compound's stability and reactivity can be influenced by the presence of the dioxaborole moiety, which is known for its ability to participate in various chemical reactions, including those involving nucleophiles. Overall, 2-Hydroxy-5,6-ditetradecyl-1,3,2-benzodioxaborole is a versatile compound with potential applications across multiple fields, including pharmaceuticals, materials science, and organic chemistry.
Formula:C34H61BO3
InChI:InChI=1S/C34H61BO3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-31-29-33-34(38-35(36)37-33)30-32(31)28-26-24-22-20-18-16-14-12-10-8-6-4-2/h29-30,36H,3-28H2,1-2H3
InChI key:InChIKey=GRYZCQIFGJNNOW-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCC)C=1C=C2C(=CC1CCCCCCCCCCCCCC)OB(O)O2
Synonyms:- 2-Hydroxy-5,6-ditetradecyl-1,3,2-benzodioxaborole
- 1,3,2-Benzodioxaborole, 2-hydroxy-5,6-ditetradecyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
