CymitQuimica logo

CAS 852524-20-0

:

4-[1-hydroxy-1-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)ethyl]Benzoic acid

Description:
4-[1-Hydroxy-1-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)ethyl]benzoic acid, with the CAS number 852524-20-0, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a tetrahydro-naphthalene derivative. This compound features a hydroxyl group and a branched aliphatic chain, contributing to its potential solubility and reactivity. The presence of multiple methyl groups in the naphthalene structure enhances its hydrophobic characteristics, which may influence its biological activity and interaction with other substances. The compound's unique structure suggests potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities and properties would require further investigation. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be of interest in studies related to drug development or materials science. As with any chemical, safety data and handling precautions should be consulted before use.
Formula:C24H30O3
InChI:InChI=1/C24H30O3/c1-15-13-19-20(23(4,5)12-11-22(19,2)3)14-18(15)24(6,27)17-9-7-16(8-10-17)21(25)26/h7-10,13-14,27H,11-12H2,1-6H3,(H,25,26)
SMILES:Cc1cc2c(cc1C(C)(c1ccc(cc1)C(=O)O)O)C(C)(C)CCC2(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.