CymitQuimica logo

CAS 852527-41-4

:

1-(4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononyl)-1H-pyrrole-2,5-dione

Description:
1-(4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononyl)-1H-pyrrole-2,5-dione, with CAS number 852527-41-4, is a synthetic organic compound characterized by its unique fluorinated alkyl chain and pyrrole structure. The presence of the tridecafluorononyl group imparts significant hydrophobicity and lipophobicity, making it useful in various applications, particularly in materials science and surface chemistry. The pyrrole-2,5-dione moiety contributes to its potential reactivity, allowing for various chemical modifications. This compound may exhibit interesting electronic properties due to the electron-withdrawing effects of the fluorinated chain, which can influence its behavior in different chemical environments. Additionally, the fluorinated segments can enhance thermal stability and chemical resistance, making it suitable for use in harsh conditions. Overall, the combination of its structural features suggests potential applications in fields such as coatings, surfactants, and advanced materials, although specific applications would depend on further research and development.
Formula:C13H8F13NO2
InChI:InChI=1S/C13H8F13NO2/c14-8(15,4-1-5-27-6(28)2-3-7(27)29)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h2-3H,1,4-5H2
InChI key:InChIKey=XCBJTYHAGWXMIM-UHFFFAOYSA-N
SMILES:C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(CCCN1C(=O)C=CC1=O)(F)F)(F)F)(F)F
Synonyms:
  • 1H-Pyrrole-2,5-dione, 1-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)-
  • 1-(4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononyl)-1H-pyrrole-2,5-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.