CymitQuimica logo

CAS 852527-48-1

:

N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl)-2-iodoacetamide

Description:
N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl)-2-iodoacetamide is a specialized chemical compound characterized by its unique fluorinated alkyl chain and iodoacetamide functional group. The presence of the heptadecafluoroundecyl moiety imparts significant hydrophobic and lipophobic properties, making it useful in various applications, including surface modification and as a surfactant. The iodoacetamide group introduces a reactive site that can participate in nucleophilic substitution reactions, enhancing its utility in organic synthesis and bioconjugation. This compound is likely to exhibit high thermal and chemical stability due to the strong carbon-fluorine bonds in the fluorinated chain. Additionally, its unique structure may contribute to specific interactions with biological systems, making it of interest in pharmaceutical and materials science research. Safety and handling precautions are essential due to the presence of iodine and the potential environmental impact of fluorinated compounds. Overall, this compound exemplifies the intersection of fluorochemistry and functional group reactivity in synthetic organic chemistry.
Formula:C13H9F17INO
InChI:InChI=1S/C13H9F17INO/c14-6(15,2-1-3-32-5(33)4-31)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h1-4H2,(H,32,33)
InChI key:InChIKey=MFTQISGNRWTJNY-UHFFFAOYSA-N
SMILES:C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(C(C(CCCNC(CI)=O)(F)F)(F)F)(F)F)(F)F
Synonyms:
  • N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl)-2-iodoacetamide
  • Acetamide, N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-2-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.