CAS 852527-60-7
:4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl azide
Description:
4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl azide, with the CAS number 852527-60-7, is a specialized chemical compound characterized by its unique structure that includes a long perfluorinated carbon chain and an azide functional group. The presence of multiple fluorine atoms imparts significant hydrophobicity and thermal stability, making it useful in various applications, including materials science and organic synthesis. The azide group is known for its reactivity, particularly in click chemistry, where it can participate in cycloaddition reactions. This compound is likely to be a colorless or pale yellow liquid or solid, depending on its specific formulation and purity. Due to the presence of the azide group, it may pose certain safety hazards, including potential explosiveness under specific conditions, necessitating careful handling and storage. Overall, this compound exemplifies the intersection of fluorinated chemistry and azide reactivity, making it a valuable substance in advanced chemical research and applications.
Formula:C9H6F13N3
InChI:InChI=1/C9H6F13N3/c10-4(11,2-1-3-24-25-23)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)22/h1-3H2
SMILES:C(CC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)CN=[N+]=[NH-]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
