CymitQuimica logo

CAS 852527-61-8

:

11-azido-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoroundecane

Description:
11-Azido-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoroundecane is a fluorinated organic compound characterized by its unique structure, which includes a long carbon chain and an azido functional group. The presence of multiple fluorine atoms imparts significant hydrophobicity and thermal stability, making it resistant to degradation in various environments. The azido group introduces potential for further chemical reactivity, particularly in click chemistry applications, where it can participate in cycloaddition reactions. This compound is typically colorless and may exhibit low volatility due to its high molecular weight and fluorinated nature. Its applications may extend to fields such as materials science, pharmaceuticals, and surface chemistry, where its unique properties can be harnessed. However, handling precautions are necessary due to the potential reactivity of the azido group, which can be explosive under certain conditions. Overall, 11-azido-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoroundecane represents a fascinating example of a specialized fluorinated compound with diverse potential applications.
Formula:C11H6F17N3
InChI:InChI=1/C11H6F17N3/c12-4(13,2-1-3-30-31-29)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h1-3H2
SMILES:C(CC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)CN=[N+]=[NH-]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.