CAS 85259-19-4
:Benzeneacetic acid, α-bromo-2-chloro-, methyl ester
Description:
Benzeneacetic acid, α-bromo-2-chloro-, methyl ester, with the CAS number 85259-19-4, is an organic compound characterized by its aromatic structure and the presence of both bromine and chlorine substituents. This compound features a benzene ring attached to an acetic acid moiety, which is further modified by the presence of a bromo group at the alpha position and a chloro group at the second carbon. As a methyl ester, it has a methoxy group (-OCH3) linked to the carboxylic acid part of the molecule. The presence of halogens typically imparts unique reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The compound is likely to exhibit moderate solubility in organic solvents and may have specific applications in the development of pharmaceuticals or agrochemicals due to its structural characteristics. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C9H8BrClO2
InChI:InChI=1/C9H8BrClO2/c1-13-9(12)4-6-2-3-7(11)5-8(6)10/h2-3,5H,4H2,1H3
InChI key:InChIKey=HMBUCZUZRQQJQD-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(Br)C1=C(Cl)C=CC=C1
Synonyms:- 2'-Bromo-2-chloro-phenylacetic acid methyl ester
- Benzeneacetic acid, α-bromo-2-chloro-, methyl ester
- Methyl 2-bromo-2-(2-chlorophenyl)acetate
- Methyl Bromo(2-Chlorophenyl)Acetate
- Methyl α-bromo-2-chlorobenzeneacetate
- Methyl α-bromo-2-chlorophenylacetate
- Methyl α-bromo-2-chlorophenylacetate ,97%
- Methyl α-bromo-α-(2-chlorophenyl)acetate
- Methyl2-Bromo-2ChlorophenylAcetate
- alpha-Bromo-2-chloro-phenylacetic acid methyl ester
- -Bromo-2-chlorophenylacetate
- α-Bromo-2-chloro benzeneacetic Acid Methyl Ester
- 2-Bromo-2-(2-chlorophenyl)acetic acid methyl ester
- Methyl alpha-bromo-2-chlorophenylacetate
- Methyl a-Bromo-2-chlorobenzeneacetat
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Methyl α-Bromo-2-chlorophenylacetate
CAS:Formula:C9H8BrClO2Purity:97%Color and Shape:LiquidMolecular weight:263.5156Methyl α-Bromo-2-Chlorophenylacetate
CAS:Methyl α-Bromo-2-ChlorophenylacetatePurity:98%Molecular weight:263.52g/molMethyl α-Bromo-2-chlorophenylacetate
CAS:Formula:C9H8BrClO2Purity:>98.0%(GC)(T)Color and Shape:White or Colorless to Light yellow powder to lump to clear liquidMolecular weight:263.52Methyl α-bromo-2-chlorophenylacetate
CAS:Formula:C9H8BrClO2Purity:95.0%Color and Shape:LiquidMolecular weight:263.52Methyl a-Bromo-2-chlorophenylacetate
CAS:Controlled Product<p>Applications Methyl α-Bromo-2-chlorophenylacetate (cas# 85259-19-4) is a compound useful in organic synthesis.<br></p>Formula:C9H8BrClO2Color and Shape:NeatMolecular weight:263.522-Bromo-2'-chlorophenyl acetic acid methyl ester
CAS:<p>2-Bromo-2'-chlorophenyl acetic acid methyl ester is a synthetic chemical that can be used as a pharmaceutical intermediate. It is prepared by the reaction of bromine with 2-chloroacetic acid and magnesium, which yields the desired product. The catalytic effect of this chemical is due to its ability to act as a catalyst for many reactions, such as the synthesis of clopidogrel. This chemical also has an industrial application in the production of other medicines, such as aspirin.</p>Formula:C9H8BrClO2Purity:Min. 95%Molecular weight:263.52 g/mol







