CAS 852691-01-1
:3-[2-(4-Chlorophenyl)ethenyl]-1H-pyrazole
Description:
3-[2-(4-Chlorophenyl)ethenyl]-1H-pyrazole, identified by its CAS number 852691-01-1, is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a vinyl group attached to the pyrazole ring, specifically a 4-chlorophenyl substituent, which contributes to its chemical properties and potential biological activity. The presence of the chlorophenyl group may enhance lipophilicity and influence interactions with biological targets. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine atom, which may affect its stability and reactivity in various chemical reactions. Additionally, the structural features suggest potential for diverse interactions in biological systems, making it a candidate for further research in medicinal chemistry and related fields.
Formula:C11H9ClN2
InChI:InChI=1S/C11H9ClN2/c12-10-4-1-9(2-5-10)3-6-11-7-8-13-14-11/h1-8H,(H,13,14)
InChI key:InChIKey=SHJXJPOMWYIJSA-UHFFFAOYSA-N
SMILES:C(=CC=1C=CNN1)C2=CC=C(Cl)C=C2
Synonyms:- 1H-Pyrazole, 3-[2-(4-chlorophenyl)ethenyl]-
- 3-[2-(4-Chlorophenyl)ethenyl]-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.