CAS 85274-81-3
:2-chloro-3-(4-chlorophenyl)quinoline
Description:
2-Chloro-3-(4-chlorophenyl)quinoline is an organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features two chlorine substituents: one at the second position of the quinoline ring and another at the para position of the phenyl group attached to the third position of the quinoline. The presence of these chlorine atoms contributes to its chemical reactivity and potential biological activity. Typically, compounds like this may exhibit properties such as antimicrobial, antitumor, or anti-inflammatory activities, making them of interest in medicinal chemistry. The molecular structure influences its solubility, stability, and interaction with biological targets. Additionally, the compound's physical properties, such as melting point and boiling point, can vary based on its purity and specific conditions. As with many chlorinated compounds, it is essential to handle 2-chloro-3-(4-chlorophenyl)quinoline with care due to potential toxicity and environmental concerns.
Formula:C15H9Cl2N
InChI:InChI=1/C15H9Cl2N/c16-12-7-5-10(6-8-12)13-9-11-3-1-2-4-14(11)18-15(13)17/h1-9H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
