CAS 85275-44-1
:2-[(1-Methyl-3-piperidinyl)thio]-3-phenylquinoline hydrochloride
Description:
2-[(1-Methyl-3-piperidinyl)thio]-3-phenylquinoline hydrochloride, with the CAS number 85275-44-1, is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a phenyl group and a thioether linkage to a piperidine derivative. This compound typically exhibits properties associated with both quinoline and piperidine derivatives, such as potential biological activity, including antimicrobial or antitumor effects. The hydrochloride salt form indicates that it is a stable, water-soluble compound, which is often advantageous for pharmaceutical applications. The presence of the piperidine moiety may contribute to its ability to interact with biological targets, potentially influencing its pharmacokinetics and pharmacodynamics. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound is of interest in medicinal chemistry and may serve as a lead compound for further drug development.
Formula:C21H23ClN2S
InChI:InChI=1/C21H22N2S.ClH/c1-23-13-7-11-18(15-23)24-21-19(16-8-3-2-4-9-16)14-17-10-5-6-12-20(17)22-21;/h2-6,8-10,12,14,18H,7,11,13,15H2,1H3;1H
SMILES:CN1CCCC(C1)Sc1c(cc2ccccc2n1)c1ccccc1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.