CymitQuimica logo

CAS 85275-48-5

:

N,N,2-Trimethyl-1-[(3-phenyl-2-quinolinyl)thio]-2-propanamine

Description:
N,N,2-Trimethyl-1-[(3-phenyl-2-quinolinyl)thio]-2-propanamine, with the CAS number 85275-48-5, is a chemical compound that belongs to the class of thioamines. This substance features a complex molecular structure characterized by a trimethylated propanamine backbone and a quinoline moiety substituted with a phenyl group. The presence of sulfur in the thio group contributes to its unique chemical reactivity and potential biological activity. Typically, compounds of this nature may exhibit properties such as moderate to high lipophilicity due to the aromatic rings, which can influence their solubility and permeability in biological systems. Additionally, the presence of multiple functional groups may allow for various interactions with biological targets, making it of interest in medicinal chemistry. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise values. Overall, this compound's structural features suggest potential applications in pharmaceuticals or as a research chemical in the study of biological systems.
Formula:C21H24N2S
InChI:InChI=1S/C21H24N2S/c1-21(2,23(3)4)15-24-20-18(16-10-6-5-7-11-16)14-17-12-8-9-13-19(17)22-20/h5-14H,15H2,1-4H3
InChI key:InChIKey=ARPRLCXPAGXBRL-UHFFFAOYSA-N
SMILES:S(CC(N(C)C)(C)C)C=1C(=CC2=C(N1)C=CC=C2)C3=CC=CC=C3
Synonyms:
  • 2-Propanamine, N,N,2-trimethyl-1-[(3-phenyl-2-quinolinyl)thio]-
  • Thromboserin
  • N,N,2-Trimethyl-1-[(3-phenyl-2-quinolinyl)thio]-2-propanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.