CAS 85278-66-6
:(2E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine
Description:
The chemical substance known as (2E)-2-(3,4-dimethoxyphenyl)-3-fluoroprop-2-en-1-amine, with the CAS number 85278-66-6, is an organic compound characterized by its unique structural features. It contains a propene backbone with a fluorine atom and an amine functional group, which contributes to its reactivity and potential biological activity. The presence of the 3,4-dimethoxyphenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. Its fluorinated structure may also impart distinct electronic properties, potentially affecting its pharmacokinetics and pharmacodynamics if used in medicinal chemistry. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, and its applications could range from research in medicinal chemistry to potential therapeutic uses, depending on its biological activity. However, specific safety and handling guidelines should be followed due to the presence of the amine and fluorine functionalities.
Formula:C11H14FNO2
InChI:InChI=1/C11H14FNO2/c1-14-10-4-3-8(5-11(10)15-2)9(6-12)7-13/h3-6H,7,13H2,1-2H3/b9-6-
SMILES:COc1ccc(cc1OC)/C(=C\F)/CN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.