CAS 85278-68-8
:3-[(E)-1-(aminomethyl)-2-fluoroethenyl]phenol
Description:
3-[(E)-1-(aminomethyl)-2-fluoroethenyl]phenol, with the CAS number 85278-68-8, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The compound features a vinyl group with an amino substituent, indicating it has both amine and alkene functionalities. The presence of a fluorine atom on the ethene moiety suggests that it may exhibit unique reactivity and properties compared to its non-fluorinated counterparts. This compound is likely to be a solid at room temperature and may have applications in pharmaceuticals or agrochemicals due to its functional groups, which can participate in various chemical reactions, including nucleophilic substitutions and polymerizations. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions influenced by the functional groups present. Safety data and handling precautions should be consulted, as compounds with amine and phenolic groups can be hazardous.
Formula:C9H10FNO
InChI:InChI=1/C9H10FNO/c10-5-8(6-11)7-2-1-3-9(12)4-7/h1-5,12H,6,11H2/b8-5-
SMILES:c1cc(cc(c1)O)/C(=C\F)/CN
Synonyms:- Phenol, 3-(1-(aminomethyl)-2-fluoroethenyl)-, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
MDL-72392
CAS:MDL-72392 is a monoamine oxidase inhibitor.Formula:C9H10FNOColor and Shape:SolidMolecular weight:167.18
