
CAS 85280-91-7
:(5Z)-7-[(1R,2R,5S)-5-Hydroxy-2-[(1E,3S)-3-hydroxy-5-phenyl-1-penten-1-yl]-3-oxocyclopentyl]-5-heptenoic acid
Description:
The chemical substance known as (5Z)-7-[(1R,2R,5S)-5-Hydroxy-2-[(1E,3S)-3-hydroxy-5-phenyl-1-penten-1-yl]-3-oxocyclopentyl]-5-heptenoic acid, with the CAS number 85280-91-7, is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a heptenoic acid backbone, indicating the presence of a long carbon chain with a double bond, which contributes to its reactivity and potential biological activity. The molecule contains multiple chiral centers, which suggests that it may exhibit specific stereochemical properties that could influence its interaction with biological systems. The presence of hydroxyl groups indicates potential for hydrogen bonding, enhancing solubility in polar solvents and possibly affecting its pharmacokinetics. Additionally, the cyclopentyl and phenyl substituents may contribute to its lipophilicity and overall molecular stability. Such structural characteristics often correlate with significant biological activities, making this compound of interest in medicinal chemistry and pharmacology.
Formula:C23H30O5
InChI:InChI=1S/C23H30O5/c24-18(13-12-17-8-4-3-5-9-17)14-15-20-19(21(25)16-22(20)26)10-6-1-2-7-11-23(27)28/h1,3-6,8-9,14-15,18-21,24-25H,2,7,10-13,16H2,(H,27,28)/b6-1-,15-14+/t18-,19+,20+,21-/m0/s1
InChI key:InChIKey=OAQGPAZDRCBBLD-YTCWWFNZSA-N
SMILES:C(/C=C\CCCC(O)=O)[C@@H]1[C@@H](/C=C/[C@H](CCC2=CC=CC=C2)O)C(=O)C[C@@H]1O
Synonyms:- 5-Heptenoic acid, 7-[(1R,2R,5S)-5-hydroxy-2-[(1E,3S)-3-hydroxy-5-phenyl-1-penten-1-yl]-3-oxocyclopentyl]-, (5Z)-
- (5Z)-7-[(1R,2R,5S)-5-Hydroxy-2-[(1E,3S)-3-hydroxy-5-phenyl-1-penten-1-yl]-3-oxocyclopentyl]-5-heptenoic acid
- 17-Phenyl-18,19,20-trinor-PGD2
- 5-Heptenoic acid, 7-[(1R,2R,5S)-5-hydroxy-2-[(1E,3S)-3-hydroxy-5-phenyl-1-pentenyl]-3-oxocyclopentyl]-, (5Z)-
- 5-Heptenoic acid, 7-[5-hydroxy-2-(3-hydroxy-5-phenyl-1-pentenyl)-3-oxocyclopentyl]-, [1R-[1α(Z),2β(1E,3S*),5α]]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
17-Phenyl-18,19,20-trinor-PGD2
CAS:17-Phenyl-18,19,20-trinor-PGD2 (17-Phenyl-PGD2), an analogue of prostaglandin D2 (PGD2), acts as a potent inhibitor of platelet aggregation induced by adenosine diphosphate (ADP), exhibiting an IC50 value of 8.4 μM, compared to PGD2's IC50 of 18.6 nM. Additionally, it serves as a weak agonist for cyclic AMP accumulation [1].Formula:C23H30O5Color and Shape:SolidMolecular weight:386.48
