CymitQuimica logo

CAS 852840-44-9

:

2-Chloro-1-[1-(2,3-dihydro-1H-inden-5-yl)-2,5-dimethyl-1H-pyrrol-3-yl]ethanone

Description:
2-Chloro-1-[1-(2,3-dihydro-1H-inden-5-yl)-2,5-dimethyl-1H-pyrrol-3-yl]ethanone, with the CAS number 852840-44-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a chloro group, a ketone functional group, and a pyrrole ring. This compound is typically classified as a heterocyclic organic molecule due to the presence of nitrogen in the pyrrole ring. It exhibits properties common to many organic compounds, such as solubility in organic solvents and potential reactivity due to the presence of the chloro and carbonyl groups. The presence of the indene moiety contributes to its unique chemical behavior and potential applications in medicinal chemistry or as an intermediate in organic synthesis. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound's structural complexity suggests potential utility in various chemical applications, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C17H18ClNO
InChI:InChI=1S/C17H18ClNO/c1-11-8-16(17(20)10-18)12(2)19(11)15-7-6-13-4-3-5-14(13)9-15/h6-9H,3-5,10H2,1-2H3
InChI key:InChIKey=ZMKIBFLIKLQOOL-UHFFFAOYSA-N
SMILES:CC=1N(C=2C=C3C(=CC2)CCC3)C(C)=CC1C(CCl)=O
Synonyms:
  • 2-Chloro-1-[1-(2,3-dihydro-1H-inden-5-yl)-2,5-dimethyl-1H-pyrrol-3-yl]ethanone
  • Ethanone, 2-chloro-1-[1-(2,3-dihydro-1H-inden-5-yl)-2,5-dimethyl-1H-pyrrol-3-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.