CymitQuimica logo

CAS 852840-57-4

:

N-Cyclohexyl-1,6-dihydro-N-methyl-6-thioxo-3-pyridinesulfonamide

Description:
N-Cyclohexyl-1,6-dihydro-N-methyl-6-thioxo-3-pyridinesulfonamide is a chemical compound characterized by its unique structural features, which include a pyridine ring, a sulfonamide group, and a thioxo moiety. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, due to the presence of the sulfonamide functional group. The cyclohexyl group contributes to its hydrophobic characteristics, which can influence its solubility and biological activity. The thioxo group may enhance its reactivity and stability under certain conditions. In terms of applications, compounds of this nature may be explored in medicinal chemistry for their potential therapeutic effects. The molecular structure suggests that it may interact with biological targets, making it of interest in drug development. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C12H18N2O2S2
InChI:InChI=1S/C12H18N2O2S2/c1-14(10-5-3-2-4-6-10)18(15,16)11-7-8-12(17)13-9-11/h7-10H,2-6H2,1H3,(H,13,17)
InChI key:InChIKey=JRKBHWGLTCWZBI-UHFFFAOYSA-N
SMILES:S(N(C)C1CCCCC1)(=O)(=O)C=2C=CC(=S)NC2
Synonyms:
  • N-Cyclohexyl-1,6-dihydro-N-methyl-6-thioxo-3-pyridinesulfonamide
  • 3-Pyridinesulfonamide, N-cyclohexyl-1,6-dihydro-N-methyl-6-thioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.