CymitQuimica logo

CAS 852840-58-5

:

5-[(Phenylsulfonyl)methyl]-2-furancarboxylic acid hydrazide

Description:
5-[(Phenylsulfonyl)methyl]-2-furancarboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a furancarboxylic acid moiety and a hydrazide functional group. This compound features a phenylsulfonyl group that enhances its reactivity and solubility properties. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of both hydrophilic (carboxylic acid and hydrazide) and hydrophobic (phenyl) components. The furancarboxylic acid structure contributes to potential biological activity, making it of interest in medicinal chemistry. Additionally, the sulfonyl group can influence the compound's interaction with biological targets, potentially enhancing its pharmacological properties. The compound may also exhibit stability under various conditions, although specific stability data would depend on environmental factors such as pH and temperature. Overall, this compound's unique functional groups suggest potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its biological activity and synthesis.
Formula:C12H12N2O4S
InChI:InChI=1S/C12H12N2O4S/c13-14-12(15)11-7-6-9(18-11)8-19(16,17)10-4-2-1-3-5-10/h1-7H,8,13H2,(H,14,15)
InChI key:InChIKey=VWAIJGGHQGXZQP-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)C1=CC=CC=C1)C=2OC(C(NN)=O)=CC2
Synonyms:
  • 5-[(Phenylsulfonyl)methyl]-2-furancarboxylic acid hydrazide
  • 2-Furancarboxylic acid, 5-[(phenylsulfonyl)methyl]-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.