
CAS 852851-70-8
:1-(4-Fluorophenyl)-2,5-dihydro-5-oxo-1H-pyrazole-3-acetic acid hydrazide
Description:
1-(4-Fluorophenyl)-2,5-dihydro-5-oxo-1H-pyrazole-3-acetic acid hydrazide, with the CAS number 852851-70-8, is a chemical compound characterized by its pyrazole core structure, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-fluorophenyl group indicates that there is a fluorine substituent on a phenyl ring, which can influence the compound's electronic properties and biological activity. The hydrazide functional group suggests potential reactivity, particularly in forming hydrazones or participating in condensation reactions. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can be influenced by the functional groups present, and it may be used in research related to pharmaceuticals or agrochemicals. As with many pyrazole derivatives, it may also be evaluated for its potential as an anti-inflammatory or analgesic agent, although specific biological data would be necessary to confirm such activities.
Formula:C11H11FN4O2
InChI:InChI=1S/C11H11FN4O2/c12-7-1-3-9(4-2-7)16-11(18)6-8(15-16)5-10(17)14-13/h1-4,6,15H,5,13H2,(H,14,17)
InChI key:InChIKey=TXWQRUOGUJKVLJ-UHFFFAOYSA-N
SMILES:O=C1N(NC(CC(NN)=O)=C1)C2=CC=C(F)C=C2
Synonyms:- 1-(4-Fluorophenyl)-2,5-dihydro-5-oxo-1H-pyrazole-3-acetic acid hydrazide
- 1H-Pyrazole-3-acetic acid, 1-(4-fluorophenyl)-2,5-dihydro-5-oxo-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.