CAS 852851-86-6
:5-(Ethylsulfonyl)-2-benzoxazolamine
Description:
5-(Ethylsulfonyl)-2-benzoxazolamine is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and an ethylsulfonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in pharmaceuticals and organic synthesis. The presence of the sulfonyl group enhances its solubility in polar solvents, while the benzoxazole moiety may impart biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are common in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact. Overall, 5-(Ethylsulfonyl)-2-benzoxazolamine represents a versatile building block in chemical research and development.
Formula:C9H10N2O3S
InChI:InChI=1S/C9H10N2O3S/c1-2-15(12,13)6-3-4-8-7(5-6)11-9(10)14-8/h3-5H,2H2,1H3,(H2,10,11)
InChI key:InChIKey=FUXAZMZRMRYBFX-UHFFFAOYSA-N
SMILES:S(CC)(=O)(=O)C=1C=C2C(=CC1)OC(N)=N2
Synonyms:- 5-(Ethylsulfonyl)-2-benzoxazolamine
- 2-Benzoxazolamine, 5-(ethylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
