CAS 85286-38-0
:L-tyrosyl-D-threonylglycyl-L-phenylalanyl-L-leucyl-D-allothreonine
Description:
L-tyrosyl-D-threonylglycyl-L-phenylalanyl-L-leucyl-D-allothreonine, with the CAS number 85286-38-0, is a synthetic peptide composed of several amino acids, including L-tyrosine, D-threonine, glycine, L-phenylalanine, L-leucine, and D-allothreonine. This compound exhibits characteristics typical of peptides, such as being soluble in water and having a specific sequence that can influence its biological activity and interactions. The presence of both L- and D-amino acids in its structure may impart unique properties, such as increased stability against enzymatic degradation. Peptides like this one are often studied for their potential roles in biological processes, including signaling pathways and as therapeutic agents. The specific arrangement of amino acids can affect the peptide's conformation, binding affinity, and overall functionality in biological systems. Additionally, the compound may be of interest in research related to drug design, protein engineering, and the development of novel therapeutic strategies.
Formula:C34H48N6O10
InChI:InChI=1/C34H48N6O10/c1-18(2)14-25(32(47)40-29(20(4)42)34(49)50)38-31(46)26(16-21-8-6-5-7-9-21)37-27(44)17-36-33(48)28(19(3)41)39-30(45)24(35)15-22-10-12-23(43)13-11-22/h5-13,18-20,24-26,28-29,41-43H,14-17,35H2,1-4H3,(H,36,48)(H,37,44)(H,38,46)(H,39,45)(H,40,47)(H,49,50)/t19-,20+,24-,25-,26-,28+,29+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Deltakephalin
CAS:Deltakephalin is a synthetic, potent specific opiate delta receptors agonist.Formula:C34H48N6O10Purity:98%Color and Shape:SolidMolecular weight:700.78(D-Thr2)-Leu-Enkephalin-Thr
CAS:(D-Thr2)-Leu-Enkephalin-Thr H-Tyr-D-Thr-Gly-Phe-Leu-Thr-OH is a peptide that belongs to the group of opioid peptides. It has been used as an experimental model for studying δ receptors and it has been shown to inhibit locomotor activity in neuro2a cells. (D-Thr2)-Leu-Enkephalin-Thr H-Tyr-D-Thr-Gly-Phe-Leu-Thr has also been shown to have a high affinity for the δ receptor. This drug has an antinociceptive effect, which may be due to its ability to inhibit enzymatic inactivation of the enzyme enkephalinase. The pK value of this drug is 9.4, which indicates that it is not very stable under physiological conditions. (D Thr2)-LeFormula:C34H48N6O10Purity:Min. 95%Molecular weight:700.78 g/molRef: 3D-FT108774
Discontinued product

