CAS 852875-96-8

Formula: C31H22O10

InChI: InChI=1S/C31H22O10/c1-39-17-5-2-14(3-6-17)25-13-24(38)30-22(36)11-21(35)28(31(30)41-25)18-8-15(4-7-19(18)33)26-12-23(37)29-20(34)9-16(32)10-27(29)40-26/h2-11,13,26,32-36H,12H2,1H3/t26-/m0/s1

InChI key: LNCNPVIQJBSDBZ-SANMLTNESA-N

SMILES: COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=C(C=CC(=C4)[C@@H]5CC(=O)C6=C(C=C(C=C6O5)O)O)O

2,3-Dihydropodocarpusflavone A

CAS: 852875-96-8

2,3-Dihydropodocarpusflavone A is a natural product for research related to life sciences. The catalog number is TN2699 and the CAS number is 852875-96-8.

Formula: C₃₁H₂₂O₁₀

Purity: 98%

Color and Shape: Solid

Molecular weight: 554.5

Ref: TM-TN2699

2,3-Dihydropodocarpusflavone A

CAS: 852875-96-8

Formula: C₃₁H₂₂O₁₀

Purity: 95%~99%

Molecular weight: 554.507

Ref: BP-SBP03338

2,3-Dihydropodocarpusflavone A

CAS: 852875-96-8

2,3-Dihydropodocarpusflavone A is a naturally occurring flavone, which is a type of polyphenolic compound. It is sourced from plants, particularly from the Podocarpaceae family, which is renowned for producing various bioactive compounds. The mode of action of 2,3-Dihydropodocarpusflavone A primarily involves its interaction with cellular pathways, where it may modulate enzyme activity, influence signal transduction, and possess antioxidant properties. These activities are of significant interest due to their potential implications in health-related research, including anti-inflammatory and anticancer studies.

Formula: C₃₁H₂₂O₁₀

Purity: Min. 95%

Molecular weight: 554.5 g/mol

Ref: 3D-CJB87596