CAS 852877-61-3

2-Cyclopropyl-4-pyridinemethanamine

Description:

2-Cyclopropyl-4-pyridinemethanamine, identified by its CAS number 852877-61-3, is a chemical compound that features a pyridine ring substituted with a cyclopropyl group and an amine functional group. This compound is characterized by its unique bicyclic structure, which contributes to its potential biological activity. The presence of the pyridine moiety often suggests that it may exhibit properties relevant to medicinal chemistry, including interactions with various biological targets. The cyclopropyl group can influence the compound's steric and electronic properties, potentially enhancing its binding affinity or selectivity for specific receptors or enzymes. Additionally, the amine group may participate in hydrogen bonding, further affecting its solubility and reactivity. While specific physical and chemical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature are typically evaluated for their pharmacological potential, including their role in drug development and therapeutic applications. Overall, 2-Cyclopropyl-4-pyridinemethanamine represents a class of compounds that may hold significance in various fields, including medicinal chemistry and pharmacology.

Formula: C₉H₁₂N₂

InChI: InChI=1S/C9H12N2/c10-6-7-3-4-11-9(5-7)8-1-2-8/h3-5,8H,1-2,6,10H2

InChI key: InChIKey=UVUFSQSQRVNXLH-UHFFFAOYSA-N

SMILES: C(N)C=1C=C(C2CC2)N=CC1

Synonyms:

• 4-Pyridinemethanamine, 2-cyclopropyl-
• [(2-Cyclopropylpyridin-4-yl)methyl]amine
• 2-Cyclopropyl-4-pyridinemethanamine
• (2-Cyclopropylpyridin-4-yl)methanamine