CAS 85292-45-1
:4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid
Description:
4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid is an organic compound characterized by its oxadiazole and benzoic acid functional groups. This compound features a phenyl group attached to a 1,3,4-oxadiazole ring, which contributes to its potential biological activity and chemical stability. The benzoic acid moiety provides acidic properties, allowing for potential interactions in various chemical environments. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the oxadiazole ring suggests potential applications in pharmaceuticals, agrochemicals, or materials science due to its unique electronic properties. Additionally, the compound may display interesting photophysical properties, making it a candidate for studies in fluorescence or luminescence. Its structure allows for various functionalization possibilities, which can be explored for enhancing its reactivity or solubility. Overall, 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid is a versatile compound with potential applications in multiple fields of chemistry.
Formula:C15H10N2O3
InChI:InChI=1/C15H10N2O3/c18-15(19)12-8-6-11(7-9-12)14-17-16-13(20-14)10-4-2-1-3-5-10/h1-9H,(H,18,19)
SMILES:c1ccc(cc1)c1nnc(c2ccc(cc2)C(=O)O)o1
Synonyms:- Benzoic acid, 4-(5-phenyl-1,3,4-oxadiazol-2-yl)-
- 4-(5-Phenyl-1,3,4-oxadiazol-2-yl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.