CAS 85293-12-5
:[(3-Methoxyphenyl)methyl]hydrazine
Description:
[(3-Methoxyphenyl)methyl]hydrazine, with the CAS number 85293-12-5, is an organic compound characterized by the presence of a hydrazine functional group attached to a methoxy-substituted phenyl ring. This compound typically exhibits properties associated with both hydrazines and aromatic compounds, including potential reactivity due to the hydrazine moiety, which can participate in various chemical reactions such as oxidation and condensation. The methoxy group enhances the compound's solubility in organic solvents and may influence its electronic properties, making it a candidate for applications in pharmaceuticals or agrochemicals. Additionally, the presence of the aromatic ring can contribute to stability and may affect the compound's interaction with biological systems. Safety considerations are important, as hydrazines are known to be toxic and potentially carcinogenic, necessitating careful handling and storage. Overall, [(3-Methoxyphenyl)methyl]hydrazine is a compound of interest in synthetic organic chemistry, with potential applications that warrant further investigation.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c1-11-8-4-2-3-7(5-8)6-10-9/h2-5,10H,6,9H2,1H3
InChI key:InChIKey=UPLGQRHDYAHDRC-UHFFFAOYSA-N
SMILES:C(NN)C1=CC(OC)=CC=C1
Synonyms:- 1-[(3-Methoxyphenyl)methyl]hydrazine
- 3-Methoxybenzylhydrazine
- Hydrazine, [(3-methoxyphenyl)methyl]-
- Hydrazine, [(3-methoxyphenyl)methyl]-, hydrochloride (1:2)
- [(3-Methoxyphenyl)methyl]hydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
[(3-methoxyphenyl)methyl]hydrazine
CAS:Formula:C8H12N2OColor and Shape:SolidMolecular weight:152.1937
