CAS 852933-49-4

4-Chloro-3-[(cyclopropylamino)sulfonyl]benzoic acid

Description:

4-Chloro-3-[(cyclopropylamino)sulfonyl]benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a chlorine atom and a cyclopropylamino group linked to a sulfonyl functional group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the amino group. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The sulfonamide group may contribute to its biological activity, possibly influencing its solubility and interaction with biological targets. Additionally, the presence of the cyclopropyl group can enhance the compound's metabolic stability and selectivity. As with many chemical substances, safety and handling precautions should be observed, as it may pose risks such as irritation or toxicity. Overall, 4-Chloro-3-[(cyclopropylamino)sulfonyl]benzoic acid represents a compound of interest in various chemical and biological research fields.

Formula: C₁₀H₁₀ClNO₄S

InChI: InChI=1S/C10H10ClNO4S/c11-8-4-1-6(10(13)14)5-9(8)17(15,16)12-7-2-3-7/h1,4-5,7,12H,2-3H2,(H,13,14)

InChI key: InChIKey=BTKQESRSEHOQDB-UHFFFAOYSA-N

SMILES: S(NC1CC1)(=O)(=O)C2=CC(C(O)=O)=CC=C2Cl

Synonyms:

• Benzoic acid, 4-chloro-3-[(cyclopropylamino)sulfonyl]-
• 4-Chloro-3-[(cyclopropylamino)sulfonyl]benzoic acid

4-Chloro-3-(cyclopropylsulfamoyl)benzoic acid

CAS: 852933-49-4

Versatile small molecule scaffold

Formula: C₁₀H₁₀ClNO₄S

Purity: Min. 95%

Molecular weight: 275.71 g/mol

Ref: 3D-CJB93349