
CAS 852934-03-3
:2-Chloro-N-1-cyclohexen-1-yl-N-(2-methoxyethyl)acetamide
Description:
2-Chloro-N-1-cyclohexen-1-yl-N-(2-methoxyethyl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro group, a cyclohexene ring, and an acetamide functional group. This compound features a cyclohexene moiety that contributes to its potential reactivity and steric properties. The presence of the chloro substituent can influence its chemical behavior, including its reactivity in nucleophilic substitution reactions. The methoxyethyl group enhances its solubility in organic solvents and may affect its biological activity. As an acetamide, it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its interactions in biological systems. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where modifications to the cyclohexene and acetamide functionalities can lead to diverse biological activities. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and safety assessments.
Formula:C11H18ClNO2
InChI:InChI=1S/C11H18ClNO2/c1-15-8-7-13(11(14)9-12)10-5-3-2-4-6-10/h5H,2-4,6-9H2,1H3
InChI key:InChIKey=SGEFBBCYMOOPBH-UHFFFAOYSA-N
SMILES:N(CCOC)(C(CCl)=O)C=1CCCCC1
Synonyms:- 2-Chloro-N-1-cyclohexen-1-yl-N-(2-methoxyethyl)acetamide
- Acetamide, 2-chloro-N-1-cyclohexen-1-yl-N-(2-methoxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.